About 3-chloro-5-ethylpyridine;ethane
3-chloro-5-ethylpyridine;ethane (PubChem CID 143545775) has the molecular formula C9H14ClN
and a molecular weight of 171.67 g/mol. Its IUPAC name is 3-chloro-5-ethylpyridine;ethane.
Molecular Properties
| Compound Name | 3-chloro-5-ethylpyridine;ethane |
| PubChem CID | 143545775 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 3-chloro-5-ethylpyridine;ethane |
| SMILES | CC.CCc1cncc(Cl)c1 |
| InChI | InChI=1S/C7H8ClN.C2H6/c1-2-6-3-7(8)5-9-4-6;1-2/h3-5H,2H2,1H3;1-2H3 |
| InChIKey | AWBVYMBCQAUCPB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-5-ethylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-ethylpyridine;ethane?
The IUPAC name of 3-chloro-5-ethylpyridine;ethane (CID 143545775) is 3-chloro-5-ethylpyridine;ethane.
What is the SMILES notation for 3-chloro-5-ethylpyridine;ethane?
The canonical SMILES for 3-chloro-5-ethylpyridine;ethane is CC.CCc1cncc(Cl)c1.
What is the InChIKey of 3-chloro-5-ethylpyridine;ethane?
The InChIKey is AWBVYMBCQAUCPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.C2H6/c1-2-6-3-7(8)5-9-4-6;1-2/h3-5H,2H2,1H3;1-2H3.
What are the key properties of 3-chloro-5-ethylpyridine;ethane?
3-chloro-5-ethylpyridine;ethane has a molecular weight of 171.67 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-ethylpyridine;ethane is sourced from PubChem (CID 143545775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).