About 3-chloro-5-octylpyridine
3-chloro-5-octylpyridine (PubChem CID 138579116) has the molecular formula C13H20ClN
and a molecular weight of 225.76 g/mol. Its IUPAC name is 3-chloro-5-octylpyridine.
Molecular Properties
| Compound Name | 3-chloro-5-octylpyridine |
| PubChem CID | 138579116 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-chloro-5-octylpyridine |
| SMILES | CCCCCCCCc1cncc(Cl)c1 |
| InChI | InChI=1S/C13H20ClN/c1-2-3-4-5-6-7-8-12-9-13(14)11-15-10-12/h9-11H,2-8H2,1H3 |
| InChIKey | WJOWEPWLHUXESY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5-octylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-octylpyridine?
The IUPAC name of 3-chloro-5-octylpyridine (CID 138579116) is 3-chloro-5-octylpyridine.
What is the SMILES notation for 3-chloro-5-octylpyridine?
The canonical SMILES for 3-chloro-5-octylpyridine is CCCCCCCCc1cncc(Cl)c1.
What is the InChIKey of 3-chloro-5-octylpyridine?
The InChIKey is WJOWEPWLHUXESY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN/c1-2-3-4-5-6-7-8-12-9-13(14)11-15-10-12/h9-11H,2-8H2,1H3.
What are the key properties of 3-chloro-5-octylpyridine?
3-chloro-5-octylpyridine has a molecular weight of 225.76 g/mol, XLogP of 4.64, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-octylpyridine is sourced from PubChem (CID 138579116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).