5-butylpyridin-3-amine;ethane;molecular hydrogen

C11H22N2 — CID 164917001

IUPAC5-butylpyridin-3-amine;ethane;molecular hydrogen
SMILESCC.CCCCc1cncc(N)c1.[H][H]
InChIInChI=1S/C9H14N2.C2H6.H2/c1-2-3-4-8-5-9(10)7-11-6-8;1-2;/h5-7H,2-4,10H2,1H3;1-2H3;1H
InChIKeyDRNPVOHAYLDTPE-UHFFFAOYSA-N
MW182.31 g/mol
LogP3.28
Rot. Bonds3

About 5-butylpyridin-3-amine;ethane;molecular hydrogen

5-butylpyridin-3-amine;ethane;molecular hydrogen (PubChem CID 164917001) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 5-butylpyridin-3-amine;ethane;molecular hydrogen.

Molecular Properties

Compound Name5-butylpyridin-3-amine;ethane;molecular hydrogen
PubChem CID164917001
Molecular FormulaC11H22N2
Molecular Weight182.31 g/mol
Exact Mass182.18
IUPAC Name5-butylpyridin-3-amine;ethane;molecular hydrogen
SMILESCC.CCCCc1cncc(N)c1.[H][H]
InChIInChI=1S/C9H14N2.C2H6.H2/c1-2-3-4-8-5-9(10)7-11-6-8;1-2;/h5-7H,2-4,10H2,1H3;1-2H3;1H
InChIKeyDRNPVOHAYLDTPE-UHFFFAOYSA-N
XLogP3.28
TPSA38.91 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.31
LogP ≤ 53.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-butylpyridin-3-amine;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-butylpyridin-3-amine;ethane;molecular hydrogen?
The IUPAC name of 5-butylpyridin-3-amine;ethane;molecular hydrogen (CID 164917001) is 5-butylpyridin-3-amine;ethane;molecular hydrogen.
What is the SMILES notation for 5-butylpyridin-3-amine;ethane;molecular hydrogen?
The canonical SMILES for 5-butylpyridin-3-amine;ethane;molecular hydrogen is CC.CCCCc1cncc(N)c1.[H][H].
What is the InChIKey of 5-butylpyridin-3-amine;ethane;molecular hydrogen?
The InChIKey is DRNPVOHAYLDTPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.C2H6.H2/c1-2-3-4-8-5-9(10)7-11-6-8;1-2;/h5-7H,2-4,10H2,1H3;1-2H3;1H.
What are the key properties of 5-butylpyridin-3-amine;ethane;molecular hydrogen?
5-butylpyridin-3-amine;ethane;molecular hydrogen has a molecular weight of 182.31 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylpyridin-3-amine;ethane;molecular hydrogen is sourced from PubChem (CID 164917001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).