C11H6Cl3N — CID 133088482
3-chloro-5-(3,5-dichlorophenyl)pyridine (PubChem CID 133088482) has the molecular formula C11H6Cl3N and a molecular weight of 258.54 g/mol. Its IUPAC name is 3-chloro-5-(3,5-dichlorophenyl)pyridine.
| Compound Name | 3-chloro-5-(3,5-dichlorophenyl)pyridine |
|---|---|
| PubChem CID | 133088482 |
| Molecular Formula | C11H6Cl3N |
| Molecular Weight | 258.54 g/mol |
| Exact Mass | 256.96 |
| IUPAC Name | 3-chloro-5-(3,5-dichlorophenyl)pyridine |
| SMILES | Clc1cncc(-c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C11H6Cl3N/c12-9-1-7(2-10(13)4-9)8-3-11(14)6-15-5-8/h1-6H |
| InChIKey | ZAUJPMXMJGCWGH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |