About 2-carbamoylprop-2-enyl 3-oxobutanoate
2-carbamoylprop-2-enyl 3-oxobutanoate (PubChem CID 141125597) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-carbamoylprop-2-enyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 2-carbamoylprop-2-enyl 3-oxobutanoate |
| PubChem CID | 141125597 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-carbamoylprop-2-enyl 3-oxobutanoate |
| SMILES | C=C(COC(=O)CC(C)=O)C(N)=O |
| InChI | InChI=1S/C8H11NO4/c1-5(8(9)12)4-13-7(11)3-6(2)10/h1,3-4H2,2H3,(H2,9,12) |
| InChIKey | DHIKRLLUDGTQGC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamoylprop-2-enyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamoylprop-2-enyl 3-oxobutanoate?
The IUPAC name of 2-carbamoylprop-2-enyl 3-oxobutanoate (CID 141125597) is 2-carbamoylprop-2-enyl 3-oxobutanoate.
What is the SMILES notation for 2-carbamoylprop-2-enyl 3-oxobutanoate?
The canonical SMILES for 2-carbamoylprop-2-enyl 3-oxobutanoate is C=C(COC(=O)CC(C)=O)C(N)=O.
What is the InChIKey of 2-carbamoylprop-2-enyl 3-oxobutanoate?
The InChIKey is DHIKRLLUDGTQGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-5(8(9)12)4-13-7(11)3-6(2)10/h1,3-4H2,2H3,(H2,9,12).
What are the key properties of 2-carbamoylprop-2-enyl 3-oxobutanoate?
2-carbamoylprop-2-enyl 3-oxobutanoate has a molecular weight of 185.18 g/mol, XLogP of -0.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoylprop-2-enyl 3-oxobutanoate is sourced from PubChem (CID 141125597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).