C12H17F3N4O3S — CID 141126366
N-[2-[(3R)-4-methylsulfonylmorpholin-3-yl]ethyl]-5-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 141126366) has the molecular formula C12H17F3N4O3S and a molecular weight of 354.35 g/mol. Its IUPAC name is N-[2-[(3R)-4-methylsulfonylmorpholin-3-yl]ethyl]-5-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[2-[(3R)-4-methylsulfonylmorpholin-3-yl]ethyl]-5-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 141126366 |
| Molecular Formula | C12H17F3N4O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-[2-[(3R)-4-methylsulfonylmorpholin-3-yl]ethyl]-5-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CS(=O)(=O)N1CCOC[C@H]1CCNc1ncncc1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N4O3S/c1-23(20,21)19-4-5-22-7-9(19)2-3-17-11-10(12(13,14)15)6-16-8-18-11/h6,8-9H,2-5,7H2,1H3,(H,16,17,18)/t9-/m1/s1 |
| InChIKey | CPNITOLUHFHWQF-SECBINFHSA-N |
| XLogP | 0.96 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |