C15H12F3NO3S2 — CID 141127456
5-[1-[4-(trifluoromethylsulfanyl)phenyl]ethylcarbamoyl]thiophene-2-carboxylic acid (PubChem CID 141127456) has the molecular formula C15H12F3NO3S2 and a molecular weight of 375.39 g/mol. Its IUPAC name is 5-[1-[4-(trifluoromethylsulfanyl)phenyl]ethylcarbamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[1-[4-(trifluoromethylsulfanyl)phenyl]ethylcarbamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 141127456 |
| Molecular Formula | C15H12F3NO3S2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 5-[1-[4-(trifluoromethylsulfanyl)phenyl]ethylcarbamoyl]thiophene-2-carboxylic acid |
| SMILES | CC(NC(=O)c1ccc(C(=O)O)s1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F3NO3S2/c1-8(9-2-4-10(5-3-9)24-15(16,17)18)19-13(20)11-6-7-12(23-11)14(21)22/h2-8H,1H3,(H,19,20)(H,21,22) |
| InChIKey | ZBIIBZCDUSVXDA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |