C19H18FNO4 — CID 141132098
benzyl (3S)-3-(1,3-dioxo-3a,4-dihydroisoindol-2-yl)-4-fluorobutanoate (PubChem CID 141132098) has the molecular formula C19H18FNO4 and a molecular weight of 343.35 g/mol. Its IUPAC name is benzyl (3S)-3-(1,3-dioxo-3a,4-dihydroisoindol-2-yl)-4-fluorobutanoate.
| Compound Name | benzyl (3S)-3-(1,3-dioxo-3a,4-dihydroisoindol-2-yl)-4-fluorobutanoate |
|---|---|
| PubChem CID | 141132098 |
| Molecular Formula | C19H18FNO4 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | benzyl (3S)-3-(1,3-dioxo-3a,4-dihydroisoindol-2-yl)-4-fluorobutanoate |
| SMILES | O=C(C[C@@H](CF)N1C(=O)C2=CC=CCC2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18FNO4/c20-11-14(10-17(22)25-12-13-6-2-1-3-7-13)21-18(23)15-8-4-5-9-16(15)19(21)24/h1-8,14,16H,9-12H2/t14-,16?/m0/s1 |
| InChIKey | IOVNTBPTMRYIDY-LBAUFKAWSA-N |
| XLogP | 2.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|