C23H28F3NO4 — CID 58885225
benzyl (1S)-4-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]-1-propan-2-ylcyclopent-2-ene-1-carboxylate (PubChem CID 58885225) has the molecular formula C23H28F3NO4 and a molecular weight of 439.47 g/mol. Its IUPAC name is benzyl (1S)-4-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]-1-propan-2-ylcyclopent-2-ene-1-carboxylate.
| Compound Name | benzyl (1S)-4-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]-1-propan-2-ylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 58885225 |
| Molecular Formula | C23H28F3NO4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | benzyl (1S)-4-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]-1-propan-2-ylcyclopent-2-ene-1-carboxylate |
| SMILES | CC(C)[C@]1(C(=O)OCc2ccccc2)C=CC(N(C(=O)C(F)(F)F)C2CCOCC2)C1 |
| InChI | InChI=1S/C23H28F3NO4/c1-16(2)22(21(29)31-15-17-6-4-3-5-7-17)11-8-19(14-22)27(20(28)23(24,25)26)18-9-12-30-13-10-18/h3-8,11,16,18-19H,9-10,12-15H2,1-2H3/t19?,22-/m0/s1 |
| InChIKey | BFKJWTTTXADDFF-BPARTEKVSA-N |
| XLogP | 4.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|