C19H24N4 — CID 141133441
N-[(3R)-1-(2-phenylethyl)pyrrolidin-3-yl]-5-prop-2-enylpyrimidin-2-amine (PubChem CID 141133441) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[(3R)-1-(2-phenylethyl)pyrrolidin-3-yl]-5-prop-2-enylpyrimidin-2-amine.
| Compound Name | N-[(3R)-1-(2-phenylethyl)pyrrolidin-3-yl]-5-prop-2-enylpyrimidin-2-amine |
|---|---|
| PubChem CID | 141133441 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[(3R)-1-(2-phenylethyl)pyrrolidin-3-yl]-5-prop-2-enylpyrimidin-2-amine |
| SMILES | C=CCc1cnc(N[C@@H]2CCN(CCc3ccccc3)C2)nc1 |
| InChI | InChI=1S/C19H24N4/c1-2-6-17-13-20-19(21-14-17)22-18-10-12-23(15-18)11-9-16-7-4-3-5-8-16/h2-5,7-8,13-14,18H,1,6,9-12,15H2,(H,20,21,22)/t18-/m1/s1 |
| InChIKey | QVJWEWVOBKTCNP-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|