C20H24N4O — CID 141133490
2-phenyl-1-[(3R)-3-[(5-prop-2-enylpyrazin-2-yl)amino]piperidin-1-yl]ethanone (PubChem CID 141133490) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-phenyl-1-[(3R)-3-[(5-prop-2-enylpyrazin-2-yl)amino]piperidin-1-yl]ethanone.
| Compound Name | 2-phenyl-1-[(3R)-3-[(5-prop-2-enylpyrazin-2-yl)amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 141133490 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-phenyl-1-[(3R)-3-[(5-prop-2-enylpyrazin-2-yl)amino]piperidin-1-yl]ethanone |
| SMILES | C=CCc1cnc(N[C@@H]2CCCN(C(=O)Cc3ccccc3)C2)cn1 |
| InChI | InChI=1S/C20H24N4O/c1-2-7-17-13-22-19(14-21-17)23-18-10-6-11-24(15-18)20(25)12-16-8-4-3-5-9-16/h2-5,8-9,13-14,18H,1,6-7,10-12,15H2,(H,22,23)/t18-/m1/s1 |
| InChIKey | GNEKOJJCXLGKKQ-GOSISDBHSA-N |
| XLogP | 2.85 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|