C18H22N4O — CID 141133442
2-[[(3R)-3-[(5-prop-2-enylpyrazin-2-yl)amino]pyrrolidin-1-yl]methyl]phenol (PubChem CID 141133442) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[[(3R)-3-[(5-prop-2-enylpyrazin-2-yl)amino]pyrrolidin-1-yl]methyl]phenol.
| Compound Name | 2-[[(3R)-3-[(5-prop-2-enylpyrazin-2-yl)amino]pyrrolidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 141133442 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[[(3R)-3-[(5-prop-2-enylpyrazin-2-yl)amino]pyrrolidin-1-yl]methyl]phenol |
| SMILES | C=CCc1cnc(N[C@@H]2CCN(Cc3ccccc3O)C2)cn1 |
| InChI | InChI=1S/C18H22N4O/c1-2-5-15-10-20-18(11-19-15)21-16-8-9-22(13-16)12-14-6-3-4-7-17(14)23/h2-4,6-7,10-11,16,23H,1,5,8-9,12-13H2,(H,20,21)/t16-/m1/s1 |
| InChIKey | UZOSZGXXGNLZDA-MRXNPFEDSA-N |
| XLogP | 2.60 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|