About N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine
N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine (PubChem CID 141134864) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine.
Analyze N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine?
The IUPAC name of N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine (CID 141134864) is N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine.
What is the SMILES notation for N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine?
The canonical SMILES for N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine is CNc1cc2[nH]ccc2[nH]1.
What is the InChIKey of N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine?
The InChIKey is JTPCPVBIHAHBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-8-7-4-6-5(10-7)2-3-9-6/h2-4,8-10H,1H3.
What are the key properties of N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine?
N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine has a molecular weight of 135.17 g/mol, XLogP of 1.54, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,4-dihydropyrrolo[3,2-b]pyrrol-5-amine is sourced from PubChem (CID 141134864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).