C8H10N4 — CID 141134926
1-N-methylbenzimidazole-1,6-diamine (PubChem CID 141134926) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 1-N-methylbenzimidazole-1,6-diamine.
| Compound Name | 1-N-methylbenzimidazole-1,6-diamine |
|---|---|
| PubChem CID | 141134926 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-N-methylbenzimidazole-1,6-diamine |
| SMILES | CNn1cnc2ccc(N)cc21 |
| InChI | InChI=1S/C8H10N4/c1-10-12-5-11-7-3-2-6(9)4-8(7)12/h2-5,10H,9H2,1H3 |
| InChIKey | MDNBEPNCCBCWSM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|