C10H14N4 — CID 141134927
1-N-propan-2-ylbenzimidazole-1,5-diamine (PubChem CID 141134927) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-N-propan-2-ylbenzimidazole-1,5-diamine.
| Compound Name | 1-N-propan-2-ylbenzimidazole-1,5-diamine |
|---|---|
| PubChem CID | 141134927 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-N-propan-2-ylbenzimidazole-1,5-diamine |
| SMILES | CC(C)Nn1cnc2cc(N)ccc21 |
| InChI | InChI=1S/C10H14N4/c1-7(2)13-14-6-12-9-5-8(11)3-4-10(9)14/h3-7,13H,11H2,1-2H3 |
| InChIKey | CHETXTOBHJLIQY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|