C22H37NO4Si — CID 141135408
benzyl 2-hydroxy-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate (PubChem CID 141135408) has the molecular formula C22H37NO4Si and a molecular weight of 407.63 g/mol. Its IUPAC name is benzyl 2-hydroxy-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate.
| Compound Name | benzyl 2-hydroxy-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 141135408 |
| Molecular Formula | C22H37NO4Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | benzyl 2-hydroxy-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate |
| SMILES | CC(C)[Si](OC1CCC(O)N(C(=O)OCc2ccccc2)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H37NO4Si/c1-16(2)28(17(3)4,18(5)6)27-20-12-13-21(24)23(14-20)22(25)26-15-19-10-8-7-9-11-19/h7-11,16-18,20-21,24H,12-15H2,1-6H3 |
| InChIKey | JOLCUIAVBGOXME-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|