C9H18FNO — CID 141137328
4-fluoro-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium (PubChem CID 141137328) has the molecular formula C9H18FNO and a molecular weight of 175.25 g/mol. Its IUPAC name is 4-fluoro-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium.
| Compound Name | 4-fluoro-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium |
|---|---|
| PubChem CID | 141137328 |
| Molecular Formula | C9H18FNO |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-fluoro-2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium |
| SMILES | CC1(C)CC(F)CC(C)(C)[NH+]1[O-] |
| InChI | InChI=1S/C9H18FNO/c1-8(2)5-7(10)6-9(3,4)11(8)12/h7,11H,5-6H2,1-4H3 |
| InChIKey | OLOICJBZRCITFJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |