C25H25NO3 — CID 141138739
4-[(1-methylcyclobutyl)-[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzoic acid (PubChem CID 141138739) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[(1-methylcyclobutyl)-[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzoic acid.
| Compound Name | 4-[(1-methylcyclobutyl)-[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 141138739 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-[(1-methylcyclobutyl)-[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzoic acid |
| SMILES | CC1(C(c2ccc(OCc3ccccn3)cc2)c2ccc(C(=O)O)cc2)CCC1 |
| InChI | InChI=1S/C25H25NO3/c1-25(14-4-15-25)23(18-6-8-20(9-7-18)24(27)28)19-10-12-22(13-11-19)29-17-21-5-2-3-16-26-21/h2-3,5-13,16,23H,4,14-15,17H2,1H3,(H,27,28) |
| InChIKey | DHPCUTHOFGANRA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |