C27H29NO3 — CID 59026741
ethyl 4-[(1-methylcyclobutyl)-[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzoate (PubChem CID 59026741) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is ethyl 4-[(1-methylcyclobutyl)-[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzoate.
| Compound Name | ethyl 4-[(1-methylcyclobutyl)-[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 59026741 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | ethyl 4-[(1-methylcyclobutyl)-[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(c2ccc(OCc3ccccn3)cc2)C2(C)CCC2)cc1 |
| InChI | InChI=1S/C27H29NO3/c1-3-30-26(29)22-10-8-20(9-11-22)25(27(2)16-6-17-27)21-12-14-24(15-13-21)31-19-23-7-4-5-18-28-23/h4-5,7-15,18,25H,3,6,16-17,19H2,1-2H3 |
| InChIKey | FLWCBGPZBFADAG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |