C19H22N4 — CID 141138744
5-[4-(2,2-dimethyl-1-phenylpropyl)phenyl]-2-methyltetrazole (PubChem CID 141138744) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 5-[4-(2,2-dimethyl-1-phenylpropyl)phenyl]-2-methyltetrazole.
| Compound Name | 5-[4-(2,2-dimethyl-1-phenylpropyl)phenyl]-2-methyltetrazole |
|---|---|
| PubChem CID | 141138744 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-[4-(2,2-dimethyl-1-phenylpropyl)phenyl]-2-methyltetrazole |
| SMILES | Cn1nnc(-c2ccc(C(c3ccccc3)C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C19H22N4/c1-19(2,3)17(14-8-6-5-7-9-14)15-10-12-16(13-11-15)18-20-22-23(4)21-18/h5-13,17H,1-4H3 |
| InChIKey | GTPDTNIJRRHDRK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |