C19H22N6O4 — CID 141138886
2-[4-[[4-amino-5-(2-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]-2-oxoacetamide (PubChem CID 141138886) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[4-[[4-amino-5-(2-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[4-[[4-amino-5-(2-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 141138886 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[4-[[4-amino-5-(2-methoxybenzoyl)pyrimidin-2-yl]amino]piperidin-1-yl]-2-oxoacetamide |
| SMILES | COc1ccccc1C(=O)c1cnc(NC2CCN(C(=O)C(N)=O)CC2)nc1N |
| InChI | InChI=1S/C19H22N6O4/c1-29-14-5-3-2-4-12(14)15(26)13-10-22-19(24-16(13)20)23-11-6-8-25(9-7-11)18(28)17(21)27/h2-5,10-11H,6-9H2,1H3,(H2,21,27)(H3,20,22,23,24) |
| InChIKey | IYUCANKIIKJNTL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|