C18H19F2N5O3 — CID 10363028
4-[[4-amino-5-(2,3-difluoro-6-methoxybenzoyl)pyrimidin-2-yl]amino]piperidine-1-carbaldehyde (PubChem CID 10363028) has the molecular formula C18H19F2N5O3 and a molecular weight of 391.38 g/mol. Its IUPAC name is 4-[[4-amino-5-(2,3-difluoro-6-methoxybenzoyl)pyrimidin-2-yl]amino]piperidine-1-carbaldehyde.
| Compound Name | 4-[[4-amino-5-(2,3-difluoro-6-methoxybenzoyl)pyrimidin-2-yl]amino]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 10363028 |
| Molecular Formula | C18H19F2N5O3 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-[[4-amino-5-(2,3-difluoro-6-methoxybenzoyl)pyrimidin-2-yl]amino]piperidine-1-carbaldehyde |
| SMILES | COc1ccc(F)c(F)c1C(=O)c1cnc(NC2CCN(C=O)CC2)nc1N |
| InChI | InChI=1S/C18H19F2N5O3/c1-28-13-3-2-12(19)15(20)14(13)16(27)11-8-22-18(24-17(11)21)23-10-4-6-25(9-26)7-5-10/h2-3,8-10H,4-7H2,1H3,(H3,21,22,23,24) |
| InChIKey | XKPCTOXMAQFWEX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|