C17H20BrN — CID 141139312
(2S)-1-bromo-1,1-diphenylpentan-2-amine (PubChem CID 141139312) has the molecular formula C17H20BrN and a molecular weight of 318.26 g/mol. Its IUPAC name is (2S)-1-bromo-1,1-diphenylpentan-2-amine.
| Compound Name | (2S)-1-bromo-1,1-diphenylpentan-2-amine |
|---|---|
| PubChem CID | 141139312 |
| Molecular Formula | C17H20BrN |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (2S)-1-bromo-1,1-diphenylpentan-2-amine |
| SMILES | CCC[C@H](N)C(Br)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20BrN/c1-2-9-16(19)17(18,14-10-5-3-6-11-14)15-12-7-4-8-13-15/h3-8,10-13,16H,2,9,19H2,1H3/t16-/m0/s1 |
| InChIKey | GNZAOVJKRSHKLW-INIZCTEOSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|