CH4N5O7PS — CID 141141027
amino sulfo 2H-tetrazol-5-yl phosphate (PubChem CID 141141027) has the molecular formula CH4N5O7PS and a molecular weight of 261.11 g/mol. Its IUPAC name is amino sulfo 2H-tetrazol-5-yl phosphate.
| Compound Name | amino sulfo 2H-tetrazol-5-yl phosphate |
|---|---|
| PubChem CID | 141141027 |
| Molecular Formula | CH4N5O7PS |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | amino sulfo 2H-tetrazol-5-yl phosphate |
| SMILES | NOP(=O)(Oc1nn[nH]n1)OS(=O)(=O)O |
| InChI | InChI=1S/CH4N5O7PS/c2-12-14(7,13-15(8,9)10)11-1-3-5-6-4-1/h2H2,(H,8,9,10)(H,3,4,5,6) |
| InChIKey | SULOKLSCUZSUPE-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 179.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|