About sulfooxy hydrogen sulfate;hydrobromide
sulfooxy hydrogen sulfate;hydrobromide (PubChem CID 172791848) has the molecular formula H3BrO8S2
and a molecular weight of 275.05 g/mol. Its IUPAC name is sulfooxy hydrogen sulfate;hydrobromide.
Molecular Properties
| Compound Name | sulfooxy hydrogen sulfate;hydrobromide |
| PubChem CID | 172791848 |
| Molecular Formula | H3BrO8S2 |
| Molecular Weight | 275.05 g/mol |
| Exact Mass | 273.85 |
| IUPAC Name | sulfooxy hydrogen sulfate;hydrobromide |
| SMILES | Br.O=S(=O)(O)OOS(=O)(=O)O |
| InChI | InChI=1S/BrH.H2O8S2/c;1-9(2,3)7-8-10(4,5)6/h1H;(H,1,2,3)(H,4,5,6) |
| InChIKey | PRDSMIBWUAJLQL-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.05 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfooxy hydrogen sulfate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfooxy hydrogen sulfate;hydrobromide?
The IUPAC name of sulfooxy hydrogen sulfate;hydrobromide (CID 172791848) is sulfooxy hydrogen sulfate;hydrobromide.
What is the SMILES notation for sulfooxy hydrogen sulfate;hydrobromide?
The canonical SMILES for sulfooxy hydrogen sulfate;hydrobromide is Br.O=S(=O)(O)OOS(=O)(=O)O.
What is the InChIKey of sulfooxy hydrogen sulfate;hydrobromide?
The InChIKey is PRDSMIBWUAJLQL-UHFFFAOYSA-N. The full InChI is InChI=1S/BrH.H2O8S2/c;1-9(2,3)7-8-10(4,5)6/h1H;(H,1,2,3)(H,4,5,6).
What are the key properties of sulfooxy hydrogen sulfate;hydrobromide?
sulfooxy hydrogen sulfate;hydrobromide has a molecular weight of 275.05 g/mol, XLogP of -0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sulfooxy hydrogen sulfate;hydrobromide is sourced from PubChem (CID 172791848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).