About sodium;sulfooxy hydrogen sulfate;hydroxide
sodium;sulfooxy hydrogen sulfate;hydroxide (PubChem CID 159457891) has the molecular formula H3NaO9S2
and a molecular weight of 234.14 g/mol. Its IUPAC name is sodium;sulfooxy hydrogen sulfate;hydroxide.
Molecular Properties
| Compound Name | sodium;sulfooxy hydrogen sulfate;hydroxide |
| PubChem CID | 159457891 |
| Molecular Formula | H3NaO9S2 |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 233.91 |
| IUPAC Name | sodium;sulfooxy hydrogen sulfate;hydroxide |
| SMILES | O=S(=O)(O)OOS(=O)(=O)O.[Na+].[OH-] |
| InChI | InChI=1S/Na.H2O8S2.H2O/c;1-9(2,3)7-8-10(4,5)6;/h;(H,1,2,3)(H,4,5,6);1H2/q+1;;/p-1 |
| InChIKey | LUFFPDAOLMCNFF-UHFFFAOYSA-M |
| XLogP | -4.63 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;sulfooxy hydrogen sulfate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;sulfooxy hydrogen sulfate;hydroxide?
The IUPAC name of sodium;sulfooxy hydrogen sulfate;hydroxide (CID 159457891) is sodium;sulfooxy hydrogen sulfate;hydroxide.
What is the SMILES notation for sodium;sulfooxy hydrogen sulfate;hydroxide?
The canonical SMILES for sodium;sulfooxy hydrogen sulfate;hydroxide is O=S(=O)(O)OOS(=O)(=O)O.[Na+].[OH-].
What is the InChIKey of sodium;sulfooxy hydrogen sulfate;hydroxide?
The InChIKey is LUFFPDAOLMCNFF-UHFFFAOYSA-M. The full InChI is InChI=1S/Na.H2O8S2.H2O/c;1-9(2,3)7-8-10(4,5)6;/h;(H,1,2,3)(H,4,5,6);1H2/q+1;;/p-1.
What are the key properties of sodium;sulfooxy hydrogen sulfate;hydroxide?
sodium;sulfooxy hydrogen sulfate;hydroxide has a molecular weight of 234.14 g/mol, XLogP of -4.63, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;sulfooxy hydrogen sulfate;hydroxide is sourced from PubChem (CID 159457891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).