About peroxyformic acid;sulfooxy hydrogen sulfate
peroxyformic acid;sulfooxy hydrogen sulfate (PubChem CID 174430614) has the molecular formula CH4O11S2
and a molecular weight of 256.17 g/mol. Its IUPAC name is peroxyformic acid;sulfooxy hydrogen sulfate.
Molecular Properties
| Compound Name | peroxyformic acid;sulfooxy hydrogen sulfate |
| PubChem CID | 174430614 |
| Molecular Formula | CH4O11S2 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 255.92 |
| IUPAC Name | peroxyformic acid;sulfooxy hydrogen sulfate |
| SMILES | O=COO.O=S(=O)(O)OOS(=O)(=O)O |
| InChI | InChI=1S/CH2O3.H2O8S2/c2-1-4-3;1-9(2,3)7-8-10(4,5)6/h1,3H;(H,1,2,3)(H,4,5,6) |
| InChIKey | PPHZHOLEIUBMSP-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 173.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze peroxyformic acid;sulfooxy hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of peroxyformic acid;sulfooxy hydrogen sulfate?
The IUPAC name of peroxyformic acid;sulfooxy hydrogen sulfate (CID 174430614) is peroxyformic acid;sulfooxy hydrogen sulfate.
What is the SMILES notation for peroxyformic acid;sulfooxy hydrogen sulfate?
The canonical SMILES for peroxyformic acid;sulfooxy hydrogen sulfate is O=COO.O=S(=O)(O)OOS(=O)(=O)O.
What is the InChIKey of peroxyformic acid;sulfooxy hydrogen sulfate?
The InChIKey is PPHZHOLEIUBMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.H2O8S2/c2-1-4-3;1-9(2,3)7-8-10(4,5)6/h1,3H;(H,1,2,3)(H,4,5,6).
What are the key properties of peroxyformic acid;sulfooxy hydrogen sulfate?
peroxyformic acid;sulfooxy hydrogen sulfate has a molecular weight of 256.17 g/mol, XLogP of -1.83, 4 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for peroxyformic acid;sulfooxy hydrogen sulfate is sourced from PubChem (CID 174430614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).