C3H12N2O10S2 — CID 175090513
azane;prop-2-enoic acid;sulfooxy hydrogen sulfate (PubChem CID 175090513) has the molecular formula C3H12N2O10S2 and a molecular weight of 300.27 g/mol. Its IUPAC name is azane;prop-2-enoic acid;sulfooxy hydrogen sulfate.
| Compound Name | azane;prop-2-enoic acid;sulfooxy hydrogen sulfate |
|---|---|
| PubChem CID | 175090513 |
| Molecular Formula | C3H12N2O10S2 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | azane;prop-2-enoic acid;sulfooxy hydrogen sulfate |
| SMILES | C=CC(=O)O.N.N.O=S(=O)(O)OOS(=O)(=O)O |
| InChI | InChI=1S/C3H4O2.2H3N.H2O8S2/c1-2-3(4)5;;;1-9(2,3)7-8-10(4,5)6/h2H,1H2,(H,4,5);2*1H3;(H,1,2,3)(H,4,5,6) |
| InChIKey | MQMQDUWUPXGYGD-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 234.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|