About potassium;hydride;sulfooxy hydrogen sulfate
potassium;hydride;sulfooxy hydrogen sulfate (PubChem CID 175284935) has the molecular formula H3KO8S2
and a molecular weight of 234.25 g/mol. Its IUPAC name is potassium;hydride;sulfooxy hydrogen sulfate.
Molecular Properties
| Compound Name | potassium;hydride;sulfooxy hydrogen sulfate |
| PubChem CID | 175284935 |
| Molecular Formula | H3KO8S2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 233.89 |
| IUPAC Name | potassium;hydride;sulfooxy hydrogen sulfate |
| SMILES | O=S(=O)(O)OOS(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/K.H2O8S2.H/c;1-9(2,3)7-8-10(4,5)6;/h;(H,1,2,3)(H,4,5,6);/q+1;;-1 |
| InChIKey | ZEVXPQSPLNAWFB-UHFFFAOYSA-N |
| XLogP | -4.34 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;sulfooxy hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;sulfooxy hydrogen sulfate?
The IUPAC name of potassium;hydride;sulfooxy hydrogen sulfate (CID 175284935) is potassium;hydride;sulfooxy hydrogen sulfate.
What is the SMILES notation for potassium;hydride;sulfooxy hydrogen sulfate?
The canonical SMILES for potassium;hydride;sulfooxy hydrogen sulfate is O=S(=O)(O)OOS(=O)(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;sulfooxy hydrogen sulfate?
The InChIKey is ZEVXPQSPLNAWFB-UHFFFAOYSA-N. The full InChI is InChI=1S/K.H2O8S2.H/c;1-9(2,3)7-8-10(4,5)6;/h;(H,1,2,3)(H,4,5,6);/q+1;;-1.
What are the key properties of potassium;hydride;sulfooxy hydrogen sulfate?
potassium;hydride;sulfooxy hydrogen sulfate has a molecular weight of 234.25 g/mol, XLogP of -4.34, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;sulfooxy hydrogen sulfate is sourced from PubChem (CID 175284935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).