C21H21NO5 — CID 141141313
2-[3-[(4-ethoxyphenyl)methyl]-6-methoxy-4-oxoquinolin-1-yl]acetic acid (PubChem CID 141141313) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[3-[(4-ethoxyphenyl)methyl]-6-methoxy-4-oxoquinolin-1-yl]acetic acid.
| Compound Name | 2-[3-[(4-ethoxyphenyl)methyl]-6-methoxy-4-oxoquinolin-1-yl]acetic acid |
|---|---|
| PubChem CID | 141141313 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[3-[(4-ethoxyphenyl)methyl]-6-methoxy-4-oxoquinolin-1-yl]acetic acid |
| SMILES | CCOc1ccc(Cc2cn(CC(=O)O)c3ccc(OC)cc3c2=O)cc1 |
| InChI | InChI=1S/C21H21NO5/c1-3-27-16-6-4-14(5-7-16)10-15-12-22(13-20(23)24)19-9-8-17(26-2)11-18(19)21(15)25/h4-9,11-12H,3,10,13H2,1-2H3,(H,23,24) |
| InChIKey | DBGTZBTZUAURRO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |