C21H21NO6 — CID 141141369
2-[4-oxo-3-[(2,3,4-trimethoxyphenyl)methyl]quinolin-1-yl]acetic acid (PubChem CID 141141369) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[4-oxo-3-[(2,3,4-trimethoxyphenyl)methyl]quinolin-1-yl]acetic acid.
| Compound Name | 2-[4-oxo-3-[(2,3,4-trimethoxyphenyl)methyl]quinolin-1-yl]acetic acid |
|---|---|
| PubChem CID | 141141369 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[4-oxo-3-[(2,3,4-trimethoxyphenyl)methyl]quinolin-1-yl]acetic acid |
| SMILES | COc1ccc(Cc2cn(CC(=O)O)c3ccccc3c2=O)c(OC)c1OC |
| InChI | InChI=1S/C21H21NO6/c1-26-17-9-8-13(20(27-2)21(17)28-3)10-14-11-22(12-18(23)24)16-7-5-4-6-15(16)19(14)25/h4-9,11H,10,12H2,1-3H3,(H,23,24) |
| InChIKey | UGAKMSKPDCNBIO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |