C18H21FN2O — CID 141141494
1-cyclopropyl-7-fluoro-9-methyl-8-piperidin-4-ylquinolizin-4-one (PubChem CID 141141494) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-cyclopropyl-7-fluoro-9-methyl-8-piperidin-4-ylquinolizin-4-one.
| Compound Name | 1-cyclopropyl-7-fluoro-9-methyl-8-piperidin-4-ylquinolizin-4-one |
|---|---|
| PubChem CID | 141141494 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-cyclopropyl-7-fluoro-9-methyl-8-piperidin-4-ylquinolizin-4-one |
| SMILES | Cc1c(C2CCNCC2)c(F)cn2c(=O)ccc(C3CC3)c12 |
| InChI | InChI=1S/C18H21FN2O/c1-11-17(13-6-8-20-9-7-13)15(19)10-21-16(22)5-4-14(18(11)21)12-2-3-12/h4-5,10,12-13,20H,2-3,6-9H2,1H3 |
| InChIKey | BXWBLCHFADHFQQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 33.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |