C23H30FN3O — CID 56615777
1-cyclopropyl-7-fluoro-9-methyl-8-(3-piperidin-2-ylpiperidin-1-yl)quinolizin-4-one (PubChem CID 56615777) has the molecular formula C23H30FN3O and a molecular weight of 383.51 g/mol. Its IUPAC name is 1-cyclopropyl-7-fluoro-9-methyl-8-(3-piperidin-2-ylpiperidin-1-yl)quinolizin-4-one.
| Compound Name | 1-cyclopropyl-7-fluoro-9-methyl-8-(3-piperidin-2-ylpiperidin-1-yl)quinolizin-4-one |
|---|---|
| PubChem CID | 56615777 |
| Molecular Formula | C23H30FN3O |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-cyclopropyl-7-fluoro-9-methyl-8-(3-piperidin-2-ylpiperidin-1-yl)quinolizin-4-one |
| SMILES | Cc1c(N2CCCC(C3CCCCN3)C2)c(F)cn2c(=O)ccc(C3CC3)c12 |
| InChI | InChI=1S/C23H30FN3O/c1-15-22-18(16-7-8-16)9-10-21(28)27(22)14-19(24)23(15)26-12-4-5-17(13-26)20-6-2-3-11-25-20/h9-10,14,16-17,20,25H,2-8,11-13H2,1H3 |
| InChIKey | TZAYWUVYRFIFIT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |