C22H25FN4O — CID 141142026
2-[4-[(3R)-3-(tert-butylamino)pyrrolidin-1-yl]-6-fluoroquinazolin-2-yl]phenol (PubChem CID 141142026) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[4-[(3R)-3-(tert-butylamino)pyrrolidin-1-yl]-6-fluoroquinazolin-2-yl]phenol.
| Compound Name | 2-[4-[(3R)-3-(tert-butylamino)pyrrolidin-1-yl]-6-fluoroquinazolin-2-yl]phenol |
|---|---|
| PubChem CID | 141142026 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[4-[(3R)-3-(tert-butylamino)pyrrolidin-1-yl]-6-fluoroquinazolin-2-yl]phenol |
| SMILES | CC(C)(C)N[C@@H]1CCN(c2nc(-c3ccccc3O)nc3ccc(F)cc23)C1 |
| InChI | InChI=1S/C22H25FN4O/c1-22(2,3)26-15-10-11-27(13-15)21-17-12-14(23)8-9-18(17)24-20(25-21)16-6-4-5-7-19(16)28/h4-9,12,15,26,28H,10-11,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | COLVVZRTIGQUEX-OAHLLOKOSA-N |
| XLogP | 4.11 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |