C19H17NO2S2 — CID 141142112
4-[2-(9H-fluoren-9-ylmethoxy)-2-hydroxyethyl]-3H-1,3-thiazole-2-thione (PubChem CID 141142112) has the molecular formula C19H17NO2S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-[2-(9H-fluoren-9-ylmethoxy)-2-hydroxyethyl]-3H-1,3-thiazole-2-thione.
| Compound Name | 4-[2-(9H-fluoren-9-ylmethoxy)-2-hydroxyethyl]-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 141142112 |
| Molecular Formula | C19H17NO2S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4-[2-(9H-fluoren-9-ylmethoxy)-2-hydroxyethyl]-3H-1,3-thiazole-2-thione |
| SMILES | OC(Cc1csc(=S)[nH]1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H17NO2S2/c21-18(9-12-11-24-19(23)20-12)22-10-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,11,17-18,21H,9-10H2,(H,20,23) |
| InChIKey | WALFLJJIHDHONZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|