C23H23NO4S2 — CID 141142132
2-[[4-[2-(9H-fluoren-9-ylmethoxy)-2-hydroxyethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoic acid (PubChem CID 141142132) has the molecular formula C23H23NO4S2 and a molecular weight of 441.57 g/mol. Its IUPAC name is 2-[[4-[2-(9H-fluoren-9-ylmethoxy)-2-hydroxyethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[[4-[2-(9H-fluoren-9-ylmethoxy)-2-hydroxyethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 141142132 |
| Molecular Formula | C23H23NO4S2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[[4-[2-(9H-fluoren-9-ylmethoxy)-2-hydroxyethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1nc(CC(O)OCC2c3ccccc3-c3ccccc32)cs1)C(=O)O |
| InChI | InChI=1S/C23H23NO4S2/c1-23(2,21(26)27)30-22-24-14(13-29-22)11-20(25)28-12-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,13,19-20,25H,11-12H2,1-2H3,(H,26,27) |
| InChIKey | WGOKVOJHPPSADA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|