About 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone
1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone (PubChem CID 141144239) has the molecular formula C15H27N3OS
and a molecular weight of 297.47 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone.
Molecular Properties
| Compound Name | 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone |
| PubChem CID | 141144239 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone |
| SMILES | O=C(CN[C@H]1CC[C@H](CN2CCSC2)C1)N1CCCC1 |
| InChI | InChI=1S/C15H27N3OS/c19-15(18-5-1-2-6-18)10-16-14-4-3-13(9-14)11-17-7-8-20-12-17/h13-14,16H,1-12H2/t13-,14-/m0/s1 |
| InChIKey | RDGXOMCQCUWKLK-KBPBESRZSA-N |
| XLogP | 1.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone?
The IUPAC name of 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone (CID 141144239) is 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone.
What is the SMILES notation for 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone?
The canonical SMILES for 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone is O=C(CN[C@H]1CC[C@H](CN2CCSC2)C1)N1CCCC1.
What is the InChIKey of 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone?
The InChIKey is RDGXOMCQCUWKLK-KBPBESRZSA-N. The full InChI is InChI=1S/C15H27N3OS/c19-15(18-5-1-2-6-18)10-16-14-4-3-13(9-14)11-17-7-8-20-12-17/h13-14,16H,1-12H2/t13-,14-/m0/s1.
What are the key properties of 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone?
1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone has a molecular weight of 297.47 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-1-yl-2-[[(1S,3S)-3-(1,3-thiazolidin-3-ylmethyl)cyclopentyl]amino]ethanone is sourced from PubChem (CID 141144239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).