C13H14FN3O2 — CID 141144470
1-[4-(3-fluoropropoxy)phenyl]pyrazole-3-carboxamide (PubChem CID 141144470) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is 1-[4-(3-fluoropropoxy)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[4-(3-fluoropropoxy)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 141144470 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-[4-(3-fluoropropoxy)phenyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1ccn(-c2ccc(OCCCF)cc2)n1 |
| InChI | InChI=1S/C13H14FN3O2/c14-7-1-9-19-11-4-2-10(3-5-11)17-8-6-12(16-17)13(15)18/h2-6,8H,1,7,9H2,(H2,15,18) |
| InChIKey | GQVDFZGWYIGHCJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|