C22H22N2O2 — CID 141145917
3-[[2-(2,4,6-trimethylphenyl)acetyl]amino]naphthalene-2-carboxamide (PubChem CID 141145917) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[[2-(2,4,6-trimethylphenyl)acetyl]amino]naphthalene-2-carboxamide.
| Compound Name | 3-[[2-(2,4,6-trimethylphenyl)acetyl]amino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 141145917 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3-[[2-(2,4,6-trimethylphenyl)acetyl]amino]naphthalene-2-carboxamide |
| SMILES | Cc1cc(C)c(CC(=O)Nc2cc3ccccc3cc2C(N)=O)c(C)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-13-8-14(2)18(15(3)9-13)12-21(25)24-20-11-17-7-5-4-6-16(17)10-19(20)22(23)26/h4-11H,12H2,1-3H3,(H2,23,26)(H,24,25) |
| InChIKey | NYKPMGZUALUZGI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |