C22H23N3O2 — CID 141145857
3-[(2,6-diethylphenyl)carbamoylamino]naphthalene-2-carboxamide (PubChem CID 141145857) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-[(2,6-diethylphenyl)carbamoylamino]naphthalene-2-carboxamide.
| Compound Name | 3-[(2,6-diethylphenyl)carbamoylamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 141145857 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 3-[(2,6-diethylphenyl)carbamoylamino]naphthalene-2-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)Nc1cc2ccccc2cc1C(N)=O |
| InChI | InChI=1S/C22H23N3O2/c1-3-14-10-7-11-15(4-2)20(14)25-22(27)24-19-13-17-9-6-5-8-16(17)12-18(19)21(23)26/h5-13H,3-4H2,1-2H3,(H2,23,26)(H2,24,25,27) |
| InChIKey | ORXOHOCAWDHNSB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |