C5H9IN2S — CID 141146937
2-ethylsulfanyl-1-iodo-4,5-dihydroimidazole (PubChem CID 141146937) has the molecular formula C5H9IN2S and a molecular weight of 256.11 g/mol. Its IUPAC name is 2-ethylsulfanyl-1-iodo-4,5-dihydroimidazole.
| Compound Name | 2-ethylsulfanyl-1-iodo-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 141146937 |
| Molecular Formula | C5H9IN2S |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 2-ethylsulfanyl-1-iodo-4,5-dihydroimidazole |
| SMILES | CCSC1=NCCN1I |
| InChI | InChI=1S/C5H9IN2S/c1-2-9-5-7-3-4-8(5)6/h2-4H2,1H3 |
| InChIKey | BJZPTYMDQFSGOH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|