hepta-1,6-dien-4-yl methyl sulfate

C8H14O4S — CID 141147379

IUPAChepta-1,6-dien-4-yl methyl sulfate
SMILESC=CCC(CC=C)OS(=O)(=O)OC
InChIInChI=1S/C8H14O4S/c1-4-6-8(7-5-2)12-13(9,10)11-3/h4-5,8H,1-2,6-7H2,3H3
InChIKeyCDVZXWVMMISMKF-UHFFFAOYSA-N
MW206.26 g/mol
LogP1.41
Rot. Bonds7

About hepta-1,6-dien-4-yl methyl sulfate

hepta-1,6-dien-4-yl methyl sulfate (PubChem CID 141147379) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is hepta-1,6-dien-4-yl methyl sulfate.

Molecular Properties

Compound Namehepta-1,6-dien-4-yl methyl sulfate
PubChem CID141147379
Molecular FormulaC8H14O4S
Molecular Weight206.26 g/mol
Exact Mass206.06
IUPAC Namehepta-1,6-dien-4-yl methyl sulfate
SMILESC=CCC(CC=C)OS(=O)(=O)OC
InChIInChI=1S/C8H14O4S/c1-4-6-8(7-5-2)12-13(9,10)11-3/h4-5,8H,1-2,6-7H2,3H3
InChIKeyCDVZXWVMMISMKF-UHFFFAOYSA-N
XLogP1.41
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.26
LogP ≤ 51.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze hepta-1,6-dien-4-yl methyl sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hepta-1,6-dien-4-yl methyl sulfate?
The IUPAC name of hepta-1,6-dien-4-yl methyl sulfate (CID 141147379) is hepta-1,6-dien-4-yl methyl sulfate.
What is the SMILES notation for hepta-1,6-dien-4-yl methyl sulfate?
The canonical SMILES for hepta-1,6-dien-4-yl methyl sulfate is C=CCC(CC=C)OS(=O)(=O)OC.
What is the InChIKey of hepta-1,6-dien-4-yl methyl sulfate?
The InChIKey is CDVZXWVMMISMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4S/c1-4-6-8(7-5-2)12-13(9,10)11-3/h4-5,8H,1-2,6-7H2,3H3.
What are the key properties of hepta-1,6-dien-4-yl methyl sulfate?
hepta-1,6-dien-4-yl methyl sulfate has a molecular weight of 206.26 g/mol, XLogP of 1.41, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,6-dien-4-yl methyl sulfate is sourced from PubChem (CID 141147379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).