C21H23FN2O5S — CID 141148482
3-[[6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]-2-(methylamino)-3-oxopropanoic acid (PubChem CID 141148482) has the molecular formula C21H23FN2O5S and a molecular weight of 434.49 g/mol. Its IUPAC name is 3-[[6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]-2-(methylamino)-3-oxopropanoic acid.
| Compound Name | 3-[[6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]-2-(methylamino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 141148482 |
| Molecular Formula | C21H23FN2O5S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 3-[[6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylamino]-2-(methylamino)-3-oxopropanoic acid |
| SMILES | CNC(C(=O)O)C(=O)NCC1CCCc2cc(S(=O)(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C21H23FN2O5S/c1-23-19(21(26)27)20(25)24-12-14-5-2-4-13-10-17(8-9-18(13)14)30(28,29)16-7-3-6-15(22)11-16/h3,6-11,14,19,23H,2,4-5,12H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | RJYNYUZGZJGUCX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|