C24H31NO — CID 141148896
1-[3-(4-methylphenyl)piperidin-1-yl]-3-(4-propan-2-ylphenyl)propan-1-one (PubChem CID 141148896) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 1-[3-(4-methylphenyl)piperidin-1-yl]-3-(4-propan-2-ylphenyl)propan-1-one.
| Compound Name | 1-[3-(4-methylphenyl)piperidin-1-yl]-3-(4-propan-2-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 141148896 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 1-[3-(4-methylphenyl)piperidin-1-yl]-3-(4-propan-2-ylphenyl)propan-1-one |
| SMILES | Cc1ccc(C2CCCN(C(=O)CCc3ccc(C(C)C)cc3)C2)cc1 |
| InChI | InChI=1S/C24H31NO/c1-18(2)21-13-8-20(9-14-21)10-15-24(26)25-16-4-5-23(17-25)22-11-6-19(3)7-12-22/h6-9,11-14,18,23H,4-5,10,15-17H2,1-3H3 |
| InChIKey | FGUSKFXYKWMBGN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |