C13H24O4 — CID 14114892
9,9-diethoxynonane-2,6-dione (PubChem CID 14114892) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 9,9-diethoxynonane-2,6-dione.
| Compound Name | 9,9-diethoxynonane-2,6-dione |
|---|---|
| PubChem CID | 14114892 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 9,9-diethoxynonane-2,6-dione |
| SMILES | CCOC(CCC(=O)CCCC(C)=O)OCC |
| InChI | InChI=1S/C13H24O4/c1-4-16-13(17-5-2)10-9-12(15)8-6-7-11(3)14/h13H,4-10H2,1-3H3 |
| InChIKey | UXSXCBRTGGWELP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|