C11H19NO2S — CID 141149018
1-[(1-methylcyclohexa-2,4-dien-1-yl)methylamino]propane-1-sulfinic acid (PubChem CID 141149018) has the molecular formula C11H19NO2S and a molecular weight of 229.35 g/mol. Its IUPAC name is 1-[(1-methylcyclohexa-2,4-dien-1-yl)methylamino]propane-1-sulfinic acid.
| Compound Name | 1-[(1-methylcyclohexa-2,4-dien-1-yl)methylamino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 141149018 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-[(1-methylcyclohexa-2,4-dien-1-yl)methylamino]propane-1-sulfinic acid |
| SMILES | CCC(NCC1(C)C=CC=CC1)S(=O)O |
| InChI | InChI=1S/C11H19NO2S/c1-3-10(15(13)14)12-9-11(2)7-5-4-6-8-11/h4-7,10,12H,3,8-9H2,1-2H3,(H,13,14) |
| InChIKey | GTYCVHYUPUOKTB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|