C18H24N2O2 — CID 141149677
(3R,6R)-3-(2,3-dihydro-1H-inden-2-yl)-6-pentan-3-ylpiperazine-2,5-dione (PubChem CID 141149677) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3R,6R)-3-(2,3-dihydro-1H-inden-2-yl)-6-pentan-3-ylpiperazine-2,5-dione.
| Compound Name | (3R,6R)-3-(2,3-dihydro-1H-inden-2-yl)-6-pentan-3-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 141149677 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (3R,6R)-3-(2,3-dihydro-1H-inden-2-yl)-6-pentan-3-ylpiperazine-2,5-dione |
| SMILES | CCC(CC)[C@H]1NC(=O)[C@@H](C2Cc3ccccc3C2)NC1=O |
| InChI | InChI=1S/C18H24N2O2/c1-3-11(4-2)15-17(21)20-16(18(22)19-15)14-9-12-7-5-6-8-13(12)10-14/h5-8,11,14-16H,3-4,9-10H2,1-2H3,(H,19,22)(H,20,21)/t15-,16-/m1/s1 |
| InChIKey | YNKQWQSWLOWXHU-HZPDHXFCSA-N |
| XLogP | 1.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |