C18H19NO5 — CID 141150426
5-(1,2,3,4,4a,10b-hexahydrophenanthridin-2-yloxy)-4,5-dioxopentanoic acid (PubChem CID 141150426) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 5-(1,2,3,4,4a,10b-hexahydrophenanthridin-2-yloxy)-4,5-dioxopentanoic acid.
| Compound Name | 5-(1,2,3,4,4a,10b-hexahydrophenanthridin-2-yloxy)-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 141150426 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 5-(1,2,3,4,4a,10b-hexahydrophenanthridin-2-yloxy)-4,5-dioxopentanoic acid |
| SMILES | O=C(O)CCC(=O)C(=O)OC1CCC2N=Cc3ccccc3C2C1 |
| InChI | InChI=1S/C18H19NO5/c20-16(7-8-17(21)22)18(23)24-12-5-6-15-14(9-12)13-4-2-1-3-11(13)10-19-15/h1-4,10,12,14-15H,5-9H2,(H,21,22) |
| InChIKey | KKHYRYWFCMOPAF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|