C19H25NO7 — CID 141121526
1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 141121526) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 141121526 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C(OC1CCC2N=Cc3ccccc3C2C1)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C19H25NO7/c21-9-15(22)16(23)17(24)18(25)19(26)27-11-5-6-14-13(7-11)12-4-2-1-3-10(12)8-20-14/h1-4,8,11,13-18,21-25H,5-7,9H2/t11?,13?,14?,15-,16-,17+,18-/m1/s1 |
| InChIKey | JVXCSBQSVOSXBG-AUPBIWLOSA-N |
| XLogP | -0.90 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |