C19H25NO7 — CID 160700766
1-ethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;(2S)-2-hydroxybutanedioic acid (PubChem CID 160700766) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-ethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;(2S)-2-hydroxybutanedioic acid.
| Compound Name | 1-ethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;(2S)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 160700766 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-ethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;(2S)-2-hydroxybutanedioic acid |
| SMILES | CCOC1C(O)CCC2N=Cc3ccccc3C21.O=C(O)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C15H19NO2.C4H6O5/c1-2-18-15-13(17)8-7-12-14(15)11-6-4-3-5-10(11)9-16-12;5-2(4(8)9)1-3(6)7/h3-6,9,12-15,17H,2,7-8H2,1H3;2,5H,1H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | RQOUZFFIDBXPFZ-WNQIDUERSA-N |
| XLogP | 1.04 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |